C8H9F3N2O2 — CID 118498517
2-(cyanomethyl)-4-(trifluoromethyl)pyrrolidine-1-carboxylic acid (PubChem CID 118498517) has the molecular formula C8H9F3N2O2 and a molecular weight of 222.17 g/mol. Its IUPAC name is 2-(cyanomethyl)-4-(trifluoromethyl)pyrrolidine-1-carboxylic acid.
| Compound Name | 2-(cyanomethyl)-4-(trifluoromethyl)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 118498517 |
| Molecular Formula | C8H9F3N2O2 |
| Molecular Weight | 222.17 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 2-(cyanomethyl)-4-(trifluoromethyl)pyrrolidine-1-carboxylic acid |
| SMILES | N#CCC1CC(C(F)(F)F)CN1C(=O)O |
| InChI | InChI=1S/C8H9F3N2O2/c9-8(10,11)5-3-6(1-2-12)13(4-5)7(14)15/h5-6H,1,3-4H2,(H,14,15) |
| InChIKey | ZLLIAYRQYJSNKP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |