About 2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine
2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine (PubChem CID 118498518) has the molecular formula C18H21ClFN3O2
and a molecular weight of 365.84 g/mol. Its IUPAC name is 2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine.
Molecular Properties
| Compound Name | 2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine |
| PubChem CID | 118498518 |
| Molecular Formula | C18H21ClFN3O2 |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine |
| SMILES | CCOc1ccc(F)c(N2CC[C@@H](Oc3cnc(Cl)cn3)[C@@H](C)C2)c1 |
| InChI | InChI=1S/C18H21ClFN3O2/c1-3-24-13-4-5-14(20)15(8-13)23-7-6-16(12(2)11-23)25-18-10-21-17(19)9-22-18/h4-5,8-10,12,16H,3,6-7,11H2,1-2H3/t12-,16+/m0/s1 |
| InChIKey | PNBCGVSZVFEJFP-BLLLJJGKSA-N |
| XLogP | 3.96 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine?
The IUPAC name of 2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine (CID 118498518) is 2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine.
What is the SMILES notation for 2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine?
The canonical SMILES for 2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine is CCOc1ccc(F)c(N2CC[C@@H](Oc3cnc(Cl)cn3)[C@@H](C)C2)c1.
What is the InChIKey of 2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine?
The InChIKey is PNBCGVSZVFEJFP-BLLLJJGKSA-N. The full InChI is InChI=1S/C18H21ClFN3O2/c1-3-24-13-4-5-14(20)15(8-13)23-7-6-16(12(2)11-23)25-18-10-21-17(19)9-22-18/h4-5,8-10,12,16H,3,6-7,11H2,1-2H3/t12-,16+/m0/s1.
What are the key properties of 2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine?
2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine has a molecular weight of 365.84 g/mol, XLogP of 3.96, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[(3S,4R)-1-(5-ethoxy-2-fluorophenyl)-3-methylpiperidin-4-yl]oxypyrazine is sourced from PubChem (CID 118498518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).