C13H23N2O3P — CID 11849888
(4aS,8aR)-2-diethoxyphosphoryl-3-methyl-4a,5,6,7,8,8a-hexahydroquinoxaline (PubChem CID 11849888) has the molecular formula C13H23N2O3P and a molecular weight of 286.31 g/mol. Its IUPAC name is (4aS,8aR)-2-diethoxyphosphoryl-3-methyl-4a,5,6,7,8,8a-hexahydroquinoxaline.
| Compound Name | (4aS,8aR)-2-diethoxyphosphoryl-3-methyl-4a,5,6,7,8,8a-hexahydroquinoxaline |
|---|---|
| PubChem CID | 11849888 |
| Molecular Formula | C13H23N2O3P |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (4aS,8aR)-2-diethoxyphosphoryl-3-methyl-4a,5,6,7,8,8a-hexahydroquinoxaline |
| SMILES | CCOP(=O)(OCC)C1=N[C@@H]2CCCC[C@@H]2N=C1C |
| InChI | InChI=1S/C13H23N2O3P/c1-4-17-19(16,18-5-2)13-10(3)14-11-8-6-7-9-12(11)15-13/h11-12H,4-9H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | NXRNKHSCHRLCJH-NWDGAFQWSA-N |
| XLogP | 3.44 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|