About 2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one
2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one (PubChem CID 118498936) has the molecular formula C10H17NO4
and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one |
| PubChem CID | 118498936 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one |
| SMILES | C=C(C)C(=O)OCCO.O=C1CCCN1 |
| InChI | InChI=1S/C6H10O3.C4H7NO/c1-5(2)6(8)9-4-3-7;6-4-2-1-3-5-4/h7H,1,3-4H2,2H3;1-3H2,(H,5,6) |
| InChIKey | MWQYIFGBFFBCSM-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one?
The IUPAC name of 2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one (CID 118498936) is 2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one.
What is the SMILES notation for 2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one?
The canonical SMILES for 2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one is C=C(C)C(=O)OCCO.O=C1CCCN1.
What is the InChIKey of 2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one?
The InChIKey is MWQYIFGBFFBCSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C4H7NO/c1-5(2)6(8)9-4-3-7;6-4-2-1-3-5-4/h7H,1,3-4H2,2H3;1-3H2,(H,5,6).
What are the key properties of 2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one?
2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one has a molecular weight of 215.25 g/mol, XLogP of -0.01, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-methylprop-2-enoate;pyrrolidin-2-one is sourced from PubChem (CID 118498936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).