C14H27N3O4 — CID 118499077
tert-butyl N-[3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl]carbamate (PubChem CID 118499077) has the molecular formula C14H27N3O4 and a molecular weight of 301.39 g/mol. Its IUPAC name is tert-butyl N-[3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 118499077 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | tert-butyl N-[3-(4-acetylpiperazin-1-yl)-2-hydroxypropyl]carbamate |
| SMILES | CC(=O)N1CCN(CC(O)CNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H27N3O4/c1-11(18)17-7-5-16(6-8-17)10-12(19)9-15-13(20)21-14(2,3)4/h12,19H,5-10H2,1-4H3,(H,15,20) |
| InChIKey | FDYIQXGINXBONF-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |