C12H20N2 — CID 118499279
3,4-dimethyl-2-(1,2,3,6-tetrahydropyridin-4-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 118499279) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 3,4-dimethyl-2-(1,2,3,6-tetrahydropyridin-4-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 3,4-dimethyl-2-(1,2,3,6-tetrahydropyridin-4-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 118499279 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 3,4-dimethyl-2-(1,2,3,6-tetrahydropyridin-4-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | CC1=CCNC(C2=CCNCC2)C1C |
| InChI | InChI=1S/C12H20N2/c1-9-3-8-14-12(10(9)2)11-4-6-13-7-5-11/h3-4,10,12-14H,5-8H2,1-2H3 |
| InChIKey | LFQZYBLNRFRPDE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|