C23H26N6O — CID 11849944
7,13-dimethyl-4-phenyl-11-(2-piperidin-4-ylethyl)-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,12-pentaen-10-one (PubChem CID 11849944) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is 7,13-dimethyl-4-phenyl-11-(2-piperidin-4-ylethyl)-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,12-pentaen-10-one.
| Compound Name | 7,13-dimethyl-4-phenyl-11-(2-piperidin-4-ylethyl)-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 11849944 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 7,13-dimethyl-4-phenyl-11-(2-piperidin-4-ylethyl)-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,12-pentaen-10-one |
| SMILES | Cc1nn(CCC2CCNCC2)c(=O)c2nc(C)n3nc(-c4ccccc4)cc3c12 |
| InChI | InChI=1S/C23H26N6O/c1-15-21-20-14-19(18-6-4-3-5-7-18)27-29(20)16(2)25-22(21)23(30)28(26-15)13-10-17-8-11-24-12-9-17/h3-7,14,17,24H,8-13H2,1-2H3 |
| InChIKey | JWELNRYLAYAYQC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |