C26H22FN5O — CID 118499487
(3R)-2'-[5-fluoro-2-(4-phenoxyanilino)pyrimidin-4-yl]spiro[1,2-dihydroindole-3,1'-cyclopropane]-6-amine (PubChem CID 118499487) has the molecular formula C26H22FN5O and a molecular weight of 439.49 g/mol. Its IUPAC name is (3R)-2'-[5-fluoro-2-(4-phenoxyanilino)pyrimidin-4-yl]spiro[1,2-dihydroindole-3,1'-cyclopropane]-6-amine.
| Compound Name | (3R)-2'-[5-fluoro-2-(4-phenoxyanilino)pyrimidin-4-yl]spiro[1,2-dihydroindole-3,1'-cyclopropane]-6-amine |
|---|---|
| PubChem CID | 118499487 |
| Molecular Formula | C26H22FN5O |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (3R)-2'-[5-fluoro-2-(4-phenoxyanilino)pyrimidin-4-yl]spiro[1,2-dihydroindole-3,1'-cyclopropane]-6-amine |
| SMILES | Nc1ccc2c(c1)NC[C@@]21CC1c1nc(Nc2ccc(Oc3ccccc3)cc2)ncc1F |
| InChI | InChI=1S/C26H22FN5O/c27-22-14-29-25(31-17-7-9-19(10-8-17)33-18-4-2-1-3-5-18)32-24(22)21-13-26(21)15-30-23-12-16(28)6-11-20(23)26/h1-12,14,21,30H,13,15,28H2,(H,29,31,32)/t21?,26-/m0/s1 |
| InChIKey | ZLMJYVGTSGEKSH-UQTORGHUSA-N |
| XLogP | 5.58 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|