C15H19NO4 — CID 118499541
8,8-dihydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylic acid (PubChem CID 118499541) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 8,8-dihydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylic acid.
| Compound Name | 8,8-dihydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 118499541 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 8,8-dihydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-4-carboxylic acid |
| SMILES | CN1CCC2(C)CC1C(O)(O)c1ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C15H19NO4/c1-14-5-6-16(2)12(8-14)15(19,20)10-4-3-9(13(17)18)7-11(10)14/h3-4,7,12,19-20H,5-6,8H2,1-2H3,(H,17,18) |
| InChIKey | WTSLOJUPFHPHRZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|