About methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate
methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate (PubChem CID 11849958) has the molecular formula C10H13N7O3
and a molecular weight of 279.26 g/mol. Its IUPAC name is methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate.
Molecular Properties
| Compound Name | methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate |
| PubChem CID | 11849958 |
| Molecular Formula | C10H13N7O3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate |
| SMILES | COC(=O)C(N/C(C#N)=C(\N)C#N)/C(C)=N\NC(N)=O |
| InChI | InChI=1S/C10H13N7O3/c1-5(16-17-10(14)19)8(9(18)20-2)15-7(4-12)6(13)3-11/h8,15H,13H2,1-2H3,(H3,14,17,19)/b7-6-,16-5- |
| InChIKey | YWXBXVLCGQFEMU-SCPOOEJGSA-N |
| XLogP | -1.62 |
| TPSA | 179.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate?
The IUPAC name of methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate (CID 11849958) is methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate.
What is the SMILES notation for methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate?
The canonical SMILES for methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate is COC(=O)C(N/C(C#N)=C(\N)C#N)/C(C)=N\NC(N)=O.
What is the InChIKey of methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate?
The InChIKey is YWXBXVLCGQFEMU-SCPOOEJGSA-N. The full InChI is InChI=1S/C10H13N7O3/c1-5(16-17-10(14)19)8(9(18)20-2)15-7(4-12)6(13)3-11/h8,15H,13H2,1-2H3,(H3,14,17,19)/b7-6-,16-5-.
What are the key properties of methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate?
methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate has a molecular weight of 279.26 g/mol, XLogP of -1.62, 5 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3Z)-2-[[(Z)-2-amino-1,2-dicyanoethenyl]amino]-3-(carbamoylhydrazinylidene)butanoate is sourced from PubChem (CID 11849958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).