C20H25F3N6O4 — CID 118499937
(2R)-2-[(1S)-2-[6-(2,5-dihydro-1H-pyrrol-1-ium-3-yl)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]-3,3-dimethylbutanoic acid;2,2,2-trifluoroacetate (PubChem CID 118499937) has the molecular formula C20H25F3N6O4 and a molecular weight of 470.45 g/mol. Its IUPAC name is (2R)-2-[(1S)-2-[6-(2,5-dihydro-1H-pyrrol-1-ium-3-yl)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]-3,3-dimethylbutanoic acid;2,2,2-trifluoroacetate.
| Compound Name | (2R)-2-[(1S)-2-[6-(2,5-dihydro-1H-pyrrol-1-ium-3-yl)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]-3,3-dimethylbutanoic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 118499937 |
| Molecular Formula | C20H25F3N6O4 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | (2R)-2-[(1S)-2-[6-(2,5-dihydro-1H-pyrrol-1-ium-3-yl)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]-3,3-dimethylbutanoic acid;2,2,2-trifluoroacetate |
| SMILES | CC(C)(C)[C@H](C(=O)O)[C@H](Cc1ccc(C2=CC[NH2+]C2)nc1)c1nn[nH]n1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C18H24N6O2.C2HF3O2/c1-18(2,3)15(17(25)26)13(16-21-23-24-22-16)8-11-4-5-14(20-9-11)12-6-7-19-10-12;3-2(4,5)1(6)7/h4-6,9,13,15,19H,7-8,10H2,1-3H3,(H,25,26)(H,21,22,23,24);(H,6,7)/t13-,15-;/m0./s1 |
| InChIKey | ODQNJXPNFSBTEQ-SLHAJLBXSA-N |
| XLogP | -0.07 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |