C20H23F3N6O3 — CID 118499939
(2,2,2-trifluoroacetyl) (2R)-2-[(1S)-2-[6-(2,5-dihydro-1H-pyrrol-3-yl)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]-3,3-dimethylbutanoate (PubChem CID 118499939) has the molecular formula C20H23F3N6O3 and a molecular weight of 452.44 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2R)-2-[(1S)-2-[6-(2,5-dihydro-1H-pyrrol-3-yl)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]-3,3-dimethylbutanoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2R)-2-[(1S)-2-[6-(2,5-dihydro-1H-pyrrol-3-yl)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 118499939 |
| Molecular Formula | C20H23F3N6O3 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2R)-2-[(1S)-2-[6-(2,5-dihydro-1H-pyrrol-3-yl)-3-pyridinyl]-1-(2H-tetrazol-5-yl)ethyl]-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)[C@H](C(=O)OC(=O)C(F)(F)F)[C@H](Cc1ccc(C2=CCNC2)nc1)c1nn[nH]n1 |
| InChI | InChI=1S/C20H23F3N6O3/c1-19(2,3)15(17(30)32-18(31)20(21,22)23)13(16-26-28-29-27-16)8-11-4-5-14(25-9-11)12-6-7-24-10-12/h4-6,9,13,15,24H,7-8,10H2,1-3H3,(H,26,27,28,29)/t13-,15-/m0/s1 |
| InChIKey | FOANVUZOZDISAS-ZFWWWQNUSA-N |
| XLogP | 2.20 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|