C31H44ClN3O6 — CID 118500002
ethyl 2-[1-[4-[(3S,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-(3-methoxypropoxy)-3-methylpyrrolidin-2-yl]acetate (PubChem CID 118500002) has the molecular formula C31H44ClN3O6 and a molecular weight of 590.16 g/mol. Its IUPAC name is ethyl 2-[1-[4-[(3S,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-(3-methoxypropoxy)-3-methylpyrrolidin-2-yl]acetate.
| Compound Name | ethyl 2-[1-[4-[(3S,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-(3-methoxypropoxy)-3-methylpyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 118500002 |
| Molecular Formula | C31H44ClN3O6 |
| Molecular Weight | 590.16 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | ethyl 2-[1-[4-[(3S,4R)-1-(5-chloro-2-methoxy-4-pyridinyl)-3-methylpiperidin-4-yl]oxyphenyl]-4-(3-methoxypropoxy)-3-methylpyrrolidin-2-yl]acetate |
| SMILES | CCOC(=O)CC1C(C)C(OCCCOC)CN1c1ccc(O[C@@H]2CCN(c3cc(OC)ncc3Cl)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C31H44ClN3O6/c1-6-39-31(36)17-26-22(3)29(40-15-7-14-37-4)20-35(26)23-8-10-24(11-9-23)41-28-12-13-34(19-21(28)2)27-16-30(38-5)33-18-25(27)32/h8-11,16,18,21-22,26,28-29H,6-7,12-15,17,19-20H2,1-5H3/t21-,22?,26?,28+,29?/m0/s1 |
| InChIKey | NXPRNQYGNKUUAM-FIELQGSCSA-N |
| XLogP | 5.24 |
| TPSA | 82.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.16 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|