C26H30FN5O3 — CID 118500108
8-[6-[3-(dimethylamino)propoxy]-2-fluoro-3-pyridinyl]-1-(3-methoxycyclobutyl)-3-methylimidazo[4,5-c]quinolin-2-one (PubChem CID 118500108) has the molecular formula C26H30FN5O3 and a molecular weight of 479.56 g/mol. Its IUPAC name is 8-[6-[3-(dimethylamino)propoxy]-2-fluoro-3-pyridinyl]-1-(3-methoxycyclobutyl)-3-methylimidazo[4,5-c]quinolin-2-one.
| Compound Name | 8-[6-[3-(dimethylamino)propoxy]-2-fluoro-3-pyridinyl]-1-(3-methoxycyclobutyl)-3-methylimidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 118500108 |
| Molecular Formula | C26H30FN5O3 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 8-[6-[3-(dimethylamino)propoxy]-2-fluoro-3-pyridinyl]-1-(3-methoxycyclobutyl)-3-methylimidazo[4,5-c]quinolin-2-one |
| SMILES | COC1CC(n2c(=O)n(C)c3cnc4ccc(-c5ccc(OCCCN(C)C)nc5F)cc4c32)C1 |
| InChI | InChI=1S/C26H30FN5O3/c1-30(2)10-5-11-35-23-9-7-19(25(27)29-23)16-6-8-21-20(12-16)24-22(15-28-21)31(3)26(33)32(24)17-13-18(14-17)34-4/h6-9,12,15,17-18H,5,10-11,13-14H2,1-4H3 |
| InChIKey | UIARIXNNMVEXGS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|