C21H17N5OS — CID 11850013
11-benzyl-7,13-dimethyl-4-thiophen-3-yl-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,12-pentaen-10-one (PubChem CID 11850013) has the molecular formula C21H17N5OS and a molecular weight of 387.47 g/mol. Its IUPAC name is 11-benzyl-7,13-dimethyl-4-thiophen-3-yl-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,12-pentaen-10-one.
| Compound Name | 11-benzyl-7,13-dimethyl-4-thiophen-3-yl-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 11850013 |
| Molecular Formula | C21H17N5OS |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 11-benzyl-7,13-dimethyl-4-thiophen-3-yl-5,6,8,11,12-pentazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,12-pentaen-10-one |
| SMILES | Cc1nn(Cc2ccccc2)c(=O)c2nc(C)n3nc(-c4ccsc4)cc3c12 |
| InChI | InChI=1S/C21H17N5OS/c1-13-19-18-10-17(16-8-9-28-12-16)24-26(18)14(2)22-20(19)21(27)25(23-13)11-15-6-4-3-5-7-15/h3-10,12H,11H2,1-2H3 |
| InChIKey | DCQDGKRFOUXALB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 65.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |