C12H19F2N — CID 118500396
1-[[1-(1,1-difluoroethyl)cyclopropyl]methyl]-4-methyl-3,6-dihydro-2H-pyridine (PubChem CID 118500396) has the molecular formula C12H19F2N and a molecular weight of 215.29 g/mol. Its IUPAC name is 1-[[1-(1,1-difluoroethyl)cyclopropyl]methyl]-4-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[[1-(1,1-difluoroethyl)cyclopropyl]methyl]-4-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 118500396 |
| Molecular Formula | C12H19F2N |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 1-[[1-(1,1-difluoroethyl)cyclopropyl]methyl]-4-methyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=CCN(CC2(C(C)(F)F)CC2)CC1 |
| InChI | InChI=1S/C12H19F2N/c1-10-3-7-15(8-4-10)9-12(5-6-12)11(2,13)14/h3H,4-9H2,1-2H3 |
| InChIKey | RRYFUFJVMAKFHN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|