C21H17N3O5S — CID 118500656
1-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonylphenyl]-4-oxopyrido[2,3-c]pyridazine-3-carboxylic acid (PubChem CID 118500656) has the molecular formula C21H17N3O5S and a molecular weight of 423.45 g/mol. Its IUPAC name is 1-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonylphenyl]-4-oxopyrido[2,3-c]pyridazine-3-carboxylic acid.
| Compound Name | 1-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonylphenyl]-4-oxopyrido[2,3-c]pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 118500656 |
| Molecular Formula | C21H17N3O5S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 1-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonylphenyl]-4-oxopyrido[2,3-c]pyridazine-3-carboxylic acid |
| SMILES | C=C/C(=C\C=C/C)S(=O)(=O)c1cccc(-n2nc(C(=O)O)c(=O)c3cccnc32)c1 |
| InChI | InChI=1S/C21H17N3O5S/c1-3-5-9-15(4-2)30(28,29)16-10-6-8-14(13-16)24-20-17(11-7-12-22-20)19(25)18(23-24)21(26)27/h3-13H,2H2,1H3,(H,26,27)/b5-3-,15-9+ |
| InChIKey | GINDEWGMXRCQAU-WURXWAMFSA-N |
| XLogP | 2.90 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|