C23H21N3O5S — CID 118500657
ethyl 1-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonylphenyl]-4-oxopyrido[2,3-c]pyridazine-3-carboxylate (PubChem CID 118500657) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is ethyl 1-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonylphenyl]-4-oxopyrido[2,3-c]pyridazine-3-carboxylate.
| Compound Name | ethyl 1-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonylphenyl]-4-oxopyrido[2,3-c]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 118500657 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | ethyl 1-[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]sulfonylphenyl]-4-oxopyrido[2,3-c]pyridazine-3-carboxylate |
| SMILES | C=C/C(=C\C=C/C)S(=O)(=O)c1cccc(-n2nc(C(=O)OCC)c(=O)c3cccnc32)c1 |
| InChI | InChI=1S/C23H21N3O5S/c1-4-7-11-17(5-2)32(29,30)18-12-8-10-16(15-18)26-22-19(13-9-14-24-22)21(27)20(25-26)23(28)31-6-3/h4-5,7-15H,2,6H2,1,3H3/b7-4-,17-11+ |
| InChIKey | FCYZKBIVZXNOSK-NFQUWTNPSA-N |
| XLogP | 3.38 |
| TPSA | 108.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|