About 4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate
4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate (PubChem CID 118500720) has the molecular formula C12H16O8
and a molecular weight of 288.25 g/mol. Its IUPAC name is 4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate.
Molecular Properties
| Compound Name | 4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate |
| PubChem CID | 118500720 |
| Molecular Formula | C12H16O8 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)OCC(O)C1CC(=O)C(O)=C1O |
| InChI | InChI=1S/C12H16O8/c1-19-9(15)2-3-10(16)20-5-8(14)6-4-7(13)12(18)11(6)17/h6,8,14,17-18H,2-5H2,1H3 |
| InChIKey | CBSNGGWPQBOVIF-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate?
The IUPAC name of 4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate (CID 118500720) is 4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate.
What is the SMILES notation for 4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate?
The canonical SMILES for 4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate is COC(=O)CCC(=O)OCC(O)C1CC(=O)C(O)=C1O.
What is the InChIKey of 4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate?
The InChIKey is CBSNGGWPQBOVIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O8/c1-19-9(15)2-3-10(16)20-5-8(14)6-4-7(13)12(18)11(6)17/h6,8,14,17-18H,2-5H2,1H3.
What are the key properties of 4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate?
4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate has a molecular weight of 288.25 g/mol, XLogP of -0.24, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[2-(2,3-dihydroxy-4-oxocyclopent-2-en-1-yl)-2-hydroxyethyl] 1-O-methyl butanedioate is sourced from PubChem (CID 118500720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).