C58H42N4O — CID 118501047
[3,5-bis(2-pyridin-2-ylphenyl)phenyl]-[3-[2-[N-[(1Z)-buta-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]-5-(2-pyridin-2-ylphenyl)phenyl]methanone (PubChem CID 118501047) has the molecular formula C58H42N4O and a molecular weight of 811.00 g/mol. Its IUPAC name is [3,5-bis(2-pyridin-2-ylphenyl)phenyl]-[3-[2-[N-[(1Z)-buta-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]-5-(2-pyridin-2-ylphenyl)phenyl]methanone.
| Compound Name | [3,5-bis(2-pyridin-2-ylphenyl)phenyl]-[3-[2-[N-[(1Z)-buta-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]-5-(2-pyridin-2-ylphenyl)phenyl]methanone |
|---|---|
| PubChem CID | 118501047 |
| Molecular Formula | C58H42N4O |
| Molecular Weight | 811.00 g/mol |
| Exact Mass | 810.34 |
| IUPAC Name | [3,5-bis(2-pyridin-2-ylphenyl)phenyl]-[3-[2-[N-[(1Z)-buta-1,3-dienyl]-C-methylcarbonimidoyl]phenyl]-5-(2-pyridin-2-ylphenyl)phenyl]methanone |
| SMILES | C=C/C=C\N=C(\C)c1ccccc1-c1cc(C(=O)c2cc(-c3ccccc3-c3ccccn3)cc(-c3ccccc3-c3ccccn3)c2)cc(-c2ccccc2-c2ccccn2)c1 |
| InChI | InChI=1S/C58H42N4O/c1-3-4-30-59-40(2)47-19-5-6-20-48(47)41-34-42(49-21-7-10-24-52(49)55-27-13-16-31-60-55)37-45(36-41)58(63)46-38-43(50-22-8-11-25-53(50)56-28-14-17-32-61-56)35-44(39-46)51-23-9-12-26-54(51)57-29-15-18-33-62-57/h3-39H,1H2,2H3/b30-4-,59-40- |
| InChIKey | IYXOKRGVHLLDJF-QJECJDKASA-N |
| XLogP | 14.28 |
| TPSA | 68.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.00 |
| LogP ≤ 5 | 14.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|