About tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate
tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate (PubChem CID 118501651) has the molecular formula C15H26O5
and a molecular weight of 286.37 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate.
Molecular Properties
| Compound Name | tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate |
| PubChem CID | 118501651 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate |
| SMILES | C=C(C)C(=O)OC(C)C(C)(O)C(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H26O5/c1-9(2)12(16)19-11(4)15(8,18)10(3)13(17)20-14(5,6)7/h10-11,18H,1H2,2-8H3 |
| InChIKey | OMIBPYYDWWDPGJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate?
The IUPAC name of tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate (CID 118501651) is tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate.
What is the SMILES notation for tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate?
The canonical SMILES for tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate is C=C(C)C(=O)OC(C)C(C)(O)C(C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate?
The InChIKey is OMIBPYYDWWDPGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O5/c1-9(2)12(16)19-11(4)15(8,18)10(3)13(17)20-14(5,6)7/h10-11,18H,1H2,2-8H3.
What are the key properties of tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate?
tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate has a molecular weight of 286.37 g/mol, XLogP of 2.22, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-hydroxy-2,3-dimethyl-4-(2-methylprop-2-enoyloxy)pentanoate is sourced from PubChem (CID 118501651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).