About [4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone
[4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone (PubChem CID 11850230) has the molecular formula C24H32O2
and a molecular weight of 352.52 g/mol. Its IUPAC name is [4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone.
Molecular Properties
| Compound Name | [4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone |
| PubChem CID | 11850230 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | [4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone |
| SMILES | CC(C)CCC[C@@H](C)CCCc1ccc(C(=O)c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C24H32O2/c1-18(2)7-4-8-19(3)9-5-10-20-13-15-21(16-14-20)24(26)22-11-6-12-23(25)17-22/h6,11-19,25H,4-5,7-10H2,1-3H3/t19-/m1/s1 |
| InChIKey | PBZWNRXLXLOFKC-LJQANCHMSA-N |
| XLogP | 6.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone?
The IUPAC name of [4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone (CID 11850230) is [4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone.
What is the SMILES notation for [4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone?
The canonical SMILES for [4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone is CC(C)CCC[C@@H](C)CCCc1ccc(C(=O)c2cccc(O)c2)cc1.
What is the InChIKey of [4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone?
The InChIKey is PBZWNRXLXLOFKC-LJQANCHMSA-N. The full InChI is InChI=1S/C24H32O2/c1-18(2)7-4-8-19(3)9-5-10-20-13-15-21(16-14-20)24(26)22-11-6-12-23(25)17-22/h6,11-19,25H,4-5,7-10H2,1-3H3/t19-/m1/s1.
What are the key properties of [4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone?
[4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone has a molecular weight of 352.52 g/mol, XLogP of 6.41, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4R)-4,8-dimethylnonyl]phenyl]-(3-hydroxyphenyl)methanone is sourced from PubChem (CID 11850230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).