About CID 11850255
CID 11850255 (PubChem CID 11850255) has the molecular formula C14H25N2O
and a molecular weight of 237.37 g/mol.
Molecular Properties
| Compound Name | CID 11850255 |
|---|
| PubChem CID | 11850255 |
|---|
| Molecular Formula | C14H25N2O |
|---|
| Molecular Weight | 237.37 g/mol |
|---|
| Exact Mass | 237.20 |
|---|
| IUPAC Name | — |
|---|
| SMILES | CN1C2CCCCC2(C)N([O])C12CCCCC2 |
|---|
| InChI | InChI=1S/C14H25N2O/c1-13-9-7-4-8-12(13)15(2)14(16(13)17)10-5-3-6-11-14/h12H,3-11H2,1-2H3 |
|---|
| InChIKey | OSDAFOCUNIKXRQ-UHFFFAOYSA-N |
|---|
| XLogP | 2.94 |
|---|
| TPSA | 26.38 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 17 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 11850255 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11850255?
The IUPAC name of CID 11850255 (CID 11850255) is not available.
What is the SMILES notation for CID 11850255?
The canonical SMILES for CID 11850255 is CN1C2CCCCC2(C)N([O])C12CCCCC2.
What is the InChIKey of CID 11850255?
The InChIKey is OSDAFOCUNIKXRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N2O/c1-13-9-7-4-8-12(13)15(2)14(16(13)17)10-5-3-6-11-14/h12H,3-11H2,1-2H3.
What are the key properties of CID 11850255?
CID 11850255 has a molecular weight of 237.37 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11850255 is sourced from PubChem (CID 11850255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).