C25H29N5O3 — CID 118503042
3-methyl-8-[6-[3-(methylamino)propoxy]-3-pyridinyl]-1-(oxan-4-yl)imidazo[4,5-c]quinolin-2-one (PubChem CID 118503042) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-methyl-8-[6-[3-(methylamino)propoxy]-3-pyridinyl]-1-(oxan-4-yl)imidazo[4,5-c]quinolin-2-one.
| Compound Name | 3-methyl-8-[6-[3-(methylamino)propoxy]-3-pyridinyl]-1-(oxan-4-yl)imidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 118503042 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 3-methyl-8-[6-[3-(methylamino)propoxy]-3-pyridinyl]-1-(oxan-4-yl)imidazo[4,5-c]quinolin-2-one |
| SMILES | CNCCCOc1ccc(-c2ccc3ncc4c(c3c2)n(C2CCOCC2)c(=O)n4C)cn1 |
| InChI | InChI=1S/C25H29N5O3/c1-26-10-3-11-33-23-7-5-18(15-28-23)17-4-6-21-20(14-17)24-22(16-27-21)29(2)25(31)30(24)19-8-12-32-13-9-19/h4-7,14-16,19,26H,3,8-13H2,1-2H3 |
| InChIKey | BHZJNQALHTWTBX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|