C12H16O4 — CID 118504392
(2-oxo-3,4,5,6,7,7a-hexahydro-1-benzofuran-3a-yl) 2-methylprop-2-enoate (PubChem CID 118504392) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (2-oxo-3,4,5,6,7,7a-hexahydro-1-benzofuran-3a-yl) 2-methylprop-2-enoate.
| Compound Name | (2-oxo-3,4,5,6,7,7a-hexahydro-1-benzofuran-3a-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118504392 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (2-oxo-3,4,5,6,7,7a-hexahydro-1-benzofuran-3a-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CCCCC1OC(=O)C2 |
| InChI | InChI=1S/C12H16O4/c1-8(2)11(14)16-12-6-4-3-5-9(12)15-10(13)7-12/h9H,1,3-7H2,2H3 |
| InChIKey | BBBWKEKWABMORW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|