C12H13F3O4 — CID 118504400
(2-oxo-3,4,5,6,7,7a-hexahydro-1-benzofuran-3a-yl) 2-(trifluoromethyl)prop-2-enoate (PubChem CID 118504400) has the molecular formula C12H13F3O4 and a molecular weight of 278.23 g/mol. Its IUPAC name is (2-oxo-3,4,5,6,7,7a-hexahydro-1-benzofuran-3a-yl) 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | (2-oxo-3,4,5,6,7,7a-hexahydro-1-benzofuran-3a-yl) 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 118504400 |
| Molecular Formula | C12H13F3O4 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (2-oxo-3,4,5,6,7,7a-hexahydro-1-benzofuran-3a-yl) 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC12CCCCC1OC(=O)C2)C(F)(F)F |
| InChI | InChI=1S/C12H13F3O4/c1-7(12(13,14)15)10(17)19-11-5-3-2-4-8(11)18-9(16)6-11/h8H,1-6H2 |
| InChIKey | ZVTBZFQIIDGTCH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|