C22H15ClFN5O2 — CID 118505224
5-[(2-chloro-4-fluoro-5-pyridin-2-ylbenzoyl)amino]-1-phenylpyrazole-3-carboxamide (PubChem CID 118505224) has the molecular formula C22H15ClFN5O2 and a molecular weight of 435.85 g/mol. Its IUPAC name is 5-[(2-chloro-4-fluoro-5-pyridin-2-ylbenzoyl)amino]-1-phenylpyrazole-3-carboxamide.
| Compound Name | 5-[(2-chloro-4-fluoro-5-pyridin-2-ylbenzoyl)amino]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 118505224 |
| Molecular Formula | C22H15ClFN5O2 |
| Molecular Weight | 435.85 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 5-[(2-chloro-4-fluoro-5-pyridin-2-ylbenzoyl)amino]-1-phenylpyrazole-3-carboxamide |
| SMILES | NC(=O)c1cc(NC(=O)c2cc(-c3ccccn3)c(F)cc2Cl)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H15ClFN5O2/c23-16-11-17(24)15(18-8-4-5-9-26-18)10-14(16)22(31)27-20-12-19(21(25)30)28-29(20)13-6-2-1-3-7-13/h1-12H,(H2,25,30)(H,27,31) |
| InChIKey | LYUWFBBAMQKLEL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.85 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |