C19H31N — CID 118506980
(3aS,6R,11aS)-3-ethenyl-1,6-dimethyl-2-[(Z)-prop-1-enyl]-3a,4,5,6,7,8,9,10,11,11a-decahydrocyclodeca[b]pyrrole (PubChem CID 118506980) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is (3aS,6R,11aS)-3-ethenyl-1,6-dimethyl-2-[(Z)-prop-1-enyl]-3a,4,5,6,7,8,9,10,11,11a-decahydrocyclodeca[b]pyrrole.
| Compound Name | (3aS,6R,11aS)-3-ethenyl-1,6-dimethyl-2-[(Z)-prop-1-enyl]-3a,4,5,6,7,8,9,10,11,11a-decahydrocyclodeca[b]pyrrole |
|---|---|
| PubChem CID | 118506980 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | (3aS,6R,11aS)-3-ethenyl-1,6-dimethyl-2-[(Z)-prop-1-enyl]-3a,4,5,6,7,8,9,10,11,11a-decahydrocyclodeca[b]pyrrole |
| SMILES | C=CC1=C(/C=C\C)N(C)[C@H]2CCCCC[C@@H](C)CC[C@@H]12 |
| InChI | InChI=1S/C19H31N/c1-5-10-18-16(6-2)17-14-13-15(3)11-8-7-9-12-19(17)20(18)4/h5-6,10,15,17,19H,2,7-9,11-14H2,1,3-4H3/b10-5-/t15-,17+,19+/m1/s1 |
| InChIKey | WUTVNDNDPUCEPH-DYMXTRGXSA-N |
| XLogP | 5.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |