About [4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone
[4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone (PubChem CID 118507052) has the molecular formula C20H20N2O4S
and a molecular weight of 384.46 g/mol. Its IUPAC name is [4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | [4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone |
| PubChem CID | 118507052 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone |
| SMILES | COc1cc(C(=O)c2csc(-c3ccccc3)n2)cc(OC)c1OCCN |
| InChI | InChI=1S/C20H20N2O4S/c1-24-16-10-14(11-17(25-2)19(16)26-9-8-21)18(23)15-12-27-20(22-15)13-6-4-3-5-7-13/h3-7,10-12H,8-9,21H2,1-2H3 |
| InChIKey | OOBLXSXHXSIGRW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone?
The IUPAC name of [4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone (CID 118507052) is [4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone.
What is the SMILES notation for [4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone?
The canonical SMILES for [4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone is COc1cc(C(=O)c2csc(-c3ccccc3)n2)cc(OC)c1OCCN.
What is the InChIKey of [4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone?
The InChIKey is OOBLXSXHXSIGRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O4S/c1-24-16-10-14(11-17(25-2)19(16)26-9-8-21)18(23)15-12-27-20(22-15)13-6-4-3-5-7-13/h3-7,10-12H,8-9,21H2,1-2H3.
What are the key properties of [4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone?
[4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone has a molecular weight of 384.46 g/mol, XLogP of 3.40, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-aminoethoxy)-3,5-dimethoxyphenyl]-(2-phenyl-1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 118507052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).