About 2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole
2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole (PubChem CID 118507065) has the molecular formula C24H21N3O3
and a molecular weight of 399.45 g/mol. Its IUPAC name is 2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole |
| PubChem CID | 118507065 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole |
| SMILES | COc1cc(-c2cccc3[nH]c(-c4ccc5[nH]ccc5c4)nc23)cc(OC)c1OC |
| InChI | InChI=1S/C24H21N3O3/c1-28-20-12-16(13-21(29-2)23(20)30-3)17-5-4-6-19-22(17)27-24(26-19)15-7-8-18-14(11-15)9-10-25-18/h4-13,25H,1-3H3,(H,26,27) |
| InChIKey | JYJCYZYNGDZLGI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 72.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole?
The IUPAC name of 2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole (CID 118507065) is 2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole.
What is the SMILES notation for 2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole?
The canonical SMILES for 2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole is COc1cc(-c2cccc3[nH]c(-c4ccc5[nH]ccc5c4)nc23)cc(OC)c1OC.
What is the InChIKey of 2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole?
The InChIKey is JYJCYZYNGDZLGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3O3/c1-28-20-12-16(13-21(29-2)23(20)30-3)17-5-4-6-19-22(17)27-24(26-19)15-7-8-18-14(11-15)9-10-25-18/h4-13,25H,1-3H3,(H,26,27).
What are the key properties of 2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole?
2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole has a molecular weight of 399.45 g/mol, XLogP of 5.40, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-5-yl)-4-(3,4,5-trimethoxyphenyl)-1H-benzimidazole is sourced from PubChem (CID 118507065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).