About 4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine
4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine (PubChem CID 118507265) has the molecular formula C10H18BrN3O2
and a molecular weight of 292.18 g/mol. Its IUPAC name is 4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine.
Molecular Properties
| Compound Name | 4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine |
| PubChem CID | 118507265 |
| Molecular Formula | C10H18BrN3O2 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine |
| SMILES | COCCN(CCOC)c1nn(C)cc1Br |
| InChI | InChI=1S/C10H18BrN3O2/c1-13-8-9(11)10(12-13)14(4-6-15-2)5-7-16-3/h8H,4-7H2,1-3H3 |
| InChIKey | QSHVOJIQNAQWNY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine?
The IUPAC name of 4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine (CID 118507265) is 4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine.
What is the SMILES notation for 4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine?
The canonical SMILES for 4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine is COCCN(CCOC)c1nn(C)cc1Br.
What is the InChIKey of 4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine?
The InChIKey is QSHVOJIQNAQWNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18BrN3O2/c1-13-8-9(11)10(12-13)14(4-6-15-2)5-7-16-3/h8H,4-7H2,1-3H3.
What are the key properties of 4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine?
4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine has a molecular weight of 292.18 g/mol, XLogP of 1.28, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,N-bis(2-methoxyethyl)-1-methylpyrazol-3-amine is sourced from PubChem (CID 118507265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).