C33H26BrN3 — CID 118507617
2-(7'-bromospiro[cyclohexane-1,9'-fluorene]-4'-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 118507617) has the molecular formula C33H26BrN3 and a molecular weight of 544.50 g/mol. Its IUPAC name is 2-(7'-bromospiro[cyclohexane-1,9'-fluorene]-4'-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(7'-bromospiro[cyclohexane-1,9'-fluorene]-4'-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 118507617 |
| Molecular Formula | C33H26BrN3 |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | 2-(7'-bromospiro[cyclohexane-1,9'-fluorene]-4'-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | Brc1ccc2c(c1)C1(CCCCC1)c1cccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)c1-2 |
| InChI | InChI=1S/C33H26BrN3/c34-24-17-18-25-28(21-24)33(19-8-3-9-20-33)27-16-10-15-26(29(25)27)32-36-30(22-11-4-1-5-12-22)35-31(37-32)23-13-6-2-7-14-23/h1-2,4-7,10-18,21H,3,8-9,19-20H2 |
| InChIKey | REYRKLOYDXCTJU-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |