C35H24BrN3 — CID 118507625
2-(7-bromo-9-methyl-9-phenylfluoren-4-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 118507625) has the molecular formula C35H24BrN3 and a molecular weight of 566.50 g/mol. Its IUPAC name is 2-(7-bromo-9-methyl-9-phenylfluoren-4-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(7-bromo-9-methyl-9-phenylfluoren-4-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 118507625 |
| Molecular Formula | C35H24BrN3 |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | 2-(7-bromo-9-methyl-9-phenylfluoren-4-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(c2ccccc2)c2cc(Br)ccc2-c2c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cccc21 |
| InChI | InChI=1S/C35H24BrN3/c1-35(25-16-9-4-10-17-25)29-19-11-18-28(31(29)27-21-20-26(36)22-30(27)35)34-38-32(23-12-5-2-6-13-23)37-33(39-34)24-14-7-3-8-15-24/h2-22H,1H3 |
| InChIKey | KGEVHVBLAKBNJQ-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |