About 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine
8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine (PubChem CID 11850765) has the molecular formula C18H18ClN7OS2
and a molecular weight of 447.98 g/mol. Its IUPAC name is 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine.
Molecular Properties
| Compound Name | 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine |
| PubChem CID | 11850765 |
| Molecular Formula | C18H18ClN7OS2 |
| Molecular Weight | 447.98 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine |
| SMILES | Nc1ncnc2c1nc(Sc1nc3cccc(Cl)c3s1)n2CCN1CCOCC1 |
| InChI | InChI=1S/C18H18ClN7OS2/c19-11-2-1-3-12-14(11)28-18(23-12)29-17-24-13-15(20)21-10-22-16(13)26(17)5-4-25-6-8-27-9-7-25/h1-3,10H,4-9H2,(H2,20,21,22) |
| InChIKey | DKJQJJXMNYJZFE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.98 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine?
The IUPAC name of 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine (CID 11850765) is 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine.
What is the SMILES notation for 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine?
The canonical SMILES for 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine is Nc1ncnc2c1nc(Sc1nc3cccc(Cl)c3s1)n2CCN1CCOCC1.
What is the InChIKey of 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine?
The InChIKey is DKJQJJXMNYJZFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClN7OS2/c19-11-2-1-3-12-14(11)28-18(23-12)29-17-24-13-15(20)21-10-22-16(13)26(17)5-4-25-6-8-27-9-7-25/h1-3,10H,4-9H2,(H2,20,21,22).
What are the key properties of 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine?
8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine has a molecular weight of 447.98 g/mol, XLogP of 3.15, 5 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-(2-morpholin-4-ylethyl)purin-6-amine is sourced from PubChem (CID 11850765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).