C19H22ClN7S2 — CID 11850766
8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-[2-(2,2-dimethylpropylamino)ethyl]purin-6-amine (PubChem CID 11850766) has the molecular formula C19H22ClN7S2 and a molecular weight of 448.02 g/mol. Its IUPAC name is 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-[2-(2,2-dimethylpropylamino)ethyl]purin-6-amine.
| Compound Name | 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-[2-(2,2-dimethylpropylamino)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 11850766 |
| Molecular Formula | C19H22ClN7S2 |
| Molecular Weight | 448.02 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-[2-(2,2-dimethylpropylamino)ethyl]purin-6-amine |
| SMILES | CC(C)(C)CNCCn1c(Sc2nc3cccc(Cl)c3s2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C19H22ClN7S2/c1-19(2,3)9-22-7-8-27-16-13(15(21)23-10-24-16)26-17(27)29-18-25-12-6-4-5-11(20)14(12)28-18/h4-6,10,22H,7-9H2,1-3H3,(H2,21,23,24) |
| InChIKey | YLCDEKPILDISJG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.02 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|