C54H32N6OS — CID 118507834
2-[8-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]dibenzothiophen-4-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 118507834) has the molecular formula C54H32N6OS and a molecular weight of 812.96 g/mol. Its IUPAC name is 2-[8-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]dibenzothiophen-4-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[8-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]dibenzothiophen-4-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 118507834 |
| Molecular Formula | C54H32N6OS |
| Molecular Weight | 812.96 g/mol |
| Exact Mass | 812.24 |
| IUPAC Name | 2-[8-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]dibenzothiophen-4-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc4c3sc3ccc(-c5ccc6oc7cccc(-c8nc(-c9ccccc9)nc(-c9ccccc9)n8)c7c6c5)cc34)n2)cc1 |
| InChI | InChI=1S/C54H32N6OS/c1-5-15-33(16-6-1)49-55-50(34-17-7-2-8-18-34)58-53(57-49)40-24-14-26-45-47(40)43-32-37(27-29-44(43)61-45)38-28-30-46-42(31-38)39-23-13-25-41(48(39)62-46)54-59-51(35-19-9-3-10-20-35)56-52(60-54)36-21-11-4-12-22-36/h1-32H |
| InChIKey | QUDKHGYERZBXTA-UHFFFAOYSA-N |
| XLogP | 13.99 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.96 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |