C54H33N7S — CID 118507837
9-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]carbazole (PubChem CID 118507837) has the molecular formula C54H33N7S and a molecular weight of 811.97 g/mol. Its IUPAC name is 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]carbazole.
| Compound Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]carbazole |
|---|---|
| PubChem CID | 118507837 |
| Molecular Formula | C54H33N7S |
| Molecular Weight | 811.97 g/mol |
| Exact Mass | 811.25 |
| IUPAC Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc4sc5ccc(-c6ccc7c(c6)c6ccccc6n7-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5c34)n2)cc1 |
| InChI | InChI=1S/C54H33N7S/c1-5-16-34(17-6-1)49-55-50(35-18-7-2-8-19-35)58-53(57-49)41-25-15-27-47-48(41)43-33-39(29-31-46(43)62-47)38-28-30-45-42(32-38)40-24-13-14-26-44(40)61(45)54-59-51(36-20-9-3-10-21-36)56-52(60-54)37-22-11-4-12-23-37/h1-33H |
| InChIKey | MGPNJUDHWUHMRK-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 82.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.97 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |