About tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate
tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate (PubChem CID 118508118) has the molecular formula C16H18FNO3S
and a molecular weight of 323.39 g/mol. Its IUPAC name is tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate.
Molecular Properties
| Compound Name | tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate |
| PubChem CID | 118508118 |
| Molecular Formula | C16H18FNO3S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate |
| SMILES | CC(O)c1cc(-c2ccc(C(=O)OC(C)(C)C)c(F)c2)ns1 |
| InChI | InChI=1S/C16H18FNO3S/c1-9(19)14-8-13(18-22-14)10-5-6-11(12(17)7-10)15(20)21-16(2,3)4/h5-9,19H,1-4H3 |
| InChIKey | UWPAPEKOCVMCAG-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate?
The IUPAC name of tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate (CID 118508118) is tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate.
What is the SMILES notation for tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate?
The canonical SMILES for tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate is CC(O)c1cc(-c2ccc(C(=O)OC(C)(C)C)c(F)c2)ns1.
What is the InChIKey of tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate?
The InChIKey is UWPAPEKOCVMCAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FNO3S/c1-9(19)14-8-13(18-22-14)10-5-6-11(12(17)7-10)15(20)21-16(2,3)4/h5-9,19H,1-4H3.
What are the key properties of tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate?
tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate has a molecular weight of 323.39 g/mol, XLogP of 3.96, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-fluoro-4-[5-(1-hydroxyethyl)-1,2-thiazol-3-yl]benzoate is sourced from PubChem (CID 118508118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).