About 5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine
5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine (PubChem CID 118508217) has the molecular formula C9H6BrF3N2
and a molecular weight of 279.06 g/mol. Its IUPAC name is 5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine |
| PubChem CID | 118508217 |
| Molecular Formula | C9H6BrF3N2 |
| Molecular Weight | 279.06 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | 5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine |
| SMILES | FC(F)(F)Cn1ccc2cc(Br)cnc21 |
| InChI | InChI=1S/C9H6BrF3N2/c10-7-3-6-1-2-15(5-9(11,12)13)8(6)14-4-7/h1-4H,5H2 |
| InChIKey | SXHFSGZTXHVZJP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.06 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine?
The IUPAC name of 5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine (CID 118508217) is 5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine?
The canonical SMILES for 5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine is FC(F)(F)Cn1ccc2cc(Br)cnc21.
What is the InChIKey of 5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine?
The InChIKey is SXHFSGZTXHVZJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrF3N2/c10-7-3-6-1-2-15(5-9(11,12)13)8(6)14-4-7/h1-4H,5H2.
What are the key properties of 5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine?
5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine has a molecular weight of 279.06 g/mol, XLogP of 3.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 118508217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).