About 9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine
9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine (PubChem CID 11850832) has the molecular formula C16H15ClN6S2
and a molecular weight of 390.93 g/mol. Its IUPAC name is 9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine.
Molecular Properties
| Compound Name | 9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine |
| PubChem CID | 11850832 |
| Molecular Formula | C16H15ClN6S2 |
| Molecular Weight | 390.93 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine |
| SMILES | CCCCn1c(Sc2nc3cccc(Cl)c3s2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C16H15ClN6S2/c1-2-3-7-23-14-11(13(18)19-8-20-14)22-15(23)25-16-21-10-6-4-5-9(17)12(10)24-16/h4-6,8H,2-3,7H2,1H3,(H2,18,19,20) |
| InChIKey | BZSWMIRBZAALJX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.93 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine?
The IUPAC name of 9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine (CID 11850832) is 9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine.
What is the SMILES notation for 9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine?
The canonical SMILES for 9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine is CCCCn1c(Sc2nc3cccc(Cl)c3s2)nc2c(N)ncnc21.
What is the InChIKey of 9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine?
The InChIKey is BZSWMIRBZAALJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClN6S2/c1-2-3-7-23-14-11(13(18)19-8-20-14)22-15(23)25-16-21-10-6-4-5-9(17)12(10)24-16/h4-6,8H,2-3,7H2,1H3,(H2,18,19,20).
What are the key properties of 9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine?
9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine has a molecular weight of 390.93 g/mol, XLogP of 4.62, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-butyl-8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]purin-6-amine is sourced from PubChem (CID 11850832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).