About 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine
8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine (PubChem CID 11850894) has the molecular formula C17H17ClN6S2
and a molecular weight of 404.95 g/mol. Its IUPAC name is 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine.
Molecular Properties
| Compound Name | 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine |
| PubChem CID | 11850894 |
| Molecular Formula | C17H17ClN6S2 |
| Molecular Weight | 404.95 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine |
| SMILES | CCCCCn1c(Sc2nc3cccc(Cl)c3s2)nc2c(N)ncnc21 |
| InChI | InChI=1S/C17H17ClN6S2/c1-2-3-4-8-24-15-12(14(19)20-9-21-15)23-16(24)26-17-22-11-7-5-6-10(18)13(11)25-17/h5-7,9H,2-4,8H2,1H3,(H2,19,20,21) |
| InChIKey | WZKXGCLWCGWQNQ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.95 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine?
The IUPAC name of 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine (CID 11850894) is 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine.
What is the SMILES notation for 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine?
The canonical SMILES for 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine is CCCCCn1c(Sc2nc3cccc(Cl)c3s2)nc2c(N)ncnc21.
What is the InChIKey of 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine?
The InChIKey is WZKXGCLWCGWQNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClN6S2/c1-2-3-4-8-24-15-12(14(19)20-9-21-15)23-16(24)26-17-22-11-7-5-6-10(18)13(11)25-17/h5-7,9H,2-4,8H2,1H3,(H2,19,20,21).
What are the key properties of 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine?
8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine has a molecular weight of 404.95 g/mol, XLogP of 5.01, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(7-chloro-1,3-benzothiazol-2-yl)sulfanyl]-9-pentylpurin-6-amine is sourced from PubChem (CID 11850894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).