About 7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole
7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole (PubChem CID 118508944) has the molecular formula C20H18N2
and a molecular weight of 286.38 g/mol. Its IUPAC name is 7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole.
Molecular Properties
| Compound Name | 7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole |
| PubChem CID | 118508944 |
| Molecular Formula | C20H18N2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole |
| SMILES | CC1C=CC=C2C(c3ccc(-c4ccccc4)cc3)=NNC21 |
| InChI | InChI=1S/C20H18N2/c1-14-6-5-9-18-19(14)21-22-20(18)17-12-10-16(11-13-17)15-7-3-2-4-8-15/h2-14,19,21H,1H3 |
| InChIKey | ITACQEAUFQJJFN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole?
The IUPAC name of 7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole (CID 118508944) is 7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole.
What is the SMILES notation for 7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole?
The canonical SMILES for 7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole is CC1C=CC=C2C(c3ccc(-c4ccccc4)cc3)=NNC21.
What is the InChIKey of 7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole?
The InChIKey is ITACQEAUFQJJFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2/c1-14-6-5-9-18-19(14)21-22-20(18)17-12-10-16(11-13-17)15-7-3-2-4-8-15/h2-14,19,21H,1H3.
What are the key properties of 7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole?
7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole has a molecular weight of 286.38 g/mol, XLogP of 4.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3-(4-phenylphenyl)-7,7a-dihydro-1H-indazole is sourced from PubChem (CID 118508944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).