About 2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane
2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane (PubChem CID 11850970) has the molecular formula C23H32O2
and a molecular weight of 340.51 g/mol. Its IUPAC name is 2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane.
Molecular Properties
| Compound Name | 2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane |
| PubChem CID | 11850970 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane |
| SMILES | CC1(C)C=CC(c2ccccc2)=C(CCCCOC2CCCCO2)C1 |
| InChI | InChI=1S/C23H32O2/c1-23(2)15-14-21(19-10-4-3-5-11-19)20(18-23)12-6-8-16-24-22-13-7-9-17-25-22/h3-5,10-11,14-15,22H,6-9,12-13,16-18H2,1-2H3 |
| InChIKey | RNUAVIWUMMHINW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane?
The IUPAC name of 2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane (CID 11850970) is 2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane.
What is the SMILES notation for 2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane?
The canonical SMILES for 2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane is CC1(C)C=CC(c2ccccc2)=C(CCCCOC2CCCCO2)C1.
What is the InChIKey of 2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane?
The InChIKey is RNUAVIWUMMHINW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32O2/c1-23(2)15-14-21(19-10-4-3-5-11-19)20(18-23)12-6-8-16-24-22-13-7-9-17-25-22/h3-5,10-11,14-15,22H,6-9,12-13,16-18H2,1-2H3.
What are the key properties of 2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane?
2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane has a molecular weight of 340.51 g/mol, XLogP of 6.14, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-yl)butoxy]oxane is sourced from PubChem (CID 11850970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).