C27H35F3N2O5Si — CID 11850986
tert-butyl 2-[[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetate (PubChem CID 11850986) has the molecular formula C27H35F3N2O5Si and a molecular weight of 552.67 g/mol. Its IUPAC name is tert-butyl 2-[[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetate.
| Compound Name | tert-butyl 2-[[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetate |
|---|---|
| PubChem CID | 11850986 |
| Molecular Formula | C27H35F3N2O5Si |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | tert-butyl 2-[[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CNC(=O)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C27H35F3N2O5Si/c1-25(2,3)37-22(33)17-31-23(34)21(32-24(35)27(28,29)30)18-36-38(26(4,5)6,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,21H,17-18H2,1-6H3,(H,31,34)(H,32,35)/t21-/m0/s1 |
| InChIKey | NMVMBYRIQUQDFC-NRFANRHFSA-N |
| XLogP | 3.07 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|