C31H41F3N2O5Si — CID 11850987
tert-butyl (2R)-2-[[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]-4-methylpent-4-enoate (PubChem CID 11850987) has the molecular formula C31H41F3N2O5Si and a molecular weight of 606.76 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]-4-methylpent-4-enoate.
| Compound Name | tert-butyl (2R)-2-[[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]-4-methylpent-4-enoate |
|---|---|
| PubChem CID | 11850987 |
| Molecular Formula | C31H41F3N2O5Si |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | tert-butyl (2R)-2-[[(2S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]-4-methylpent-4-enoate |
| SMILES | C=C(C)C[C@@H](NC(=O)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H41F3N2O5Si/c1-21(2)19-24(27(38)41-29(3,4)5)35-26(37)25(36-28(39)31(32,33)34)20-40-42(30(6,7)8,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,24-25H,1,19-20H2,2-8H3,(H,35,37)(H,36,39)/t24-,25+/m1/s1 |
| InChIKey | DHTATZILDXNCQI-RPBOFIJWSA-N |
| XLogP | 4.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|