C23H37F3O10S — CID 118510274
2-[2-[2-[2-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 118510274) has the molecular formula C23H37F3O10S and a molecular weight of 562.60 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118510274 |
| Molecular Formula | C23H37F3O10S |
| Molecular Weight | 562.60 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(2,2,2-trifluoroethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H37F3O10S/c1-21-2-4-22(5-3-21)37(27,28)36-19-18-34-15-14-32-11-10-30-7-6-29-8-9-31-12-13-33-16-17-35-20-23(24,25)26/h2-5H,6-20H2,1H3 |
| InChIKey | QADLLANNASASKC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.60 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|