About 2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one
2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one (PubChem CID 11851035) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one |
| PubChem CID | 11851035 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one |
| SMILES | C=CCC1(CC=C)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C15H15NO2/c1-3-10-15(11-4-2)14(17)18-13(16-15)12-8-6-5-7-9-12/h3-9H,1-2,10-11H2 |
| InChIKey | IIYTWSDCWYMTOA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one?
The IUPAC name of 2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one (CID 11851035) is 2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one.
What is the SMILES notation for 2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one?
The canonical SMILES for 2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one is C=CCC1(CC=C)N=C(c2ccccc2)OC1=O.
What is the InChIKey of 2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one?
The InChIKey is IIYTWSDCWYMTOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c1-3-10-15(11-4-2)14(17)18-13(16-15)12-8-6-5-7-9-12/h3-9H,1-2,10-11H2.
What are the key properties of 2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one?
2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one has a molecular weight of 241.29 g/mol, XLogP of 2.88, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-4,4-bis(prop-2-enyl)-1,3-oxazol-5-one is sourced from PubChem (CID 11851035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).