C24H26Cl2F4N6O — CID 118510380
1-[(1R)-1-[3-(7-ethoxy-6-fluoroquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]-3-methylpyrrolidin-3-amine;dihydrochloride (PubChem CID 118510380) has the molecular formula C24H26Cl2F4N6O and a molecular weight of 561.41 g/mol. Its IUPAC name is 1-[(1R)-1-[3-(7-ethoxy-6-fluoroquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]-3-methylpyrrolidin-3-amine;dihydrochloride.
| Compound Name | 1-[(1R)-1-[3-(7-ethoxy-6-fluoroquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]-3-methylpyrrolidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 118510380 |
| Molecular Formula | C24H26Cl2F4N6O |
| Molecular Weight | 561.41 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 1-[(1R)-1-[3-(7-ethoxy-6-fluoroquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]-3-methylpyrrolidin-3-amine;dihydrochloride |
| SMILES | CCOc1cc2nc(-c3nnc4ccc([C@@H](N5CCC(C)(N)C5)C(F)(F)F)cn34)ccc2cc1F.Cl.Cl |
| InChI | InChI=1S/C24H24F4N6O.2ClH/c1-3-35-19-11-18-14(10-16(19)25)4-6-17(30-18)22-32-31-20-7-5-15(12-34(20)22)21(24(26,27)28)33-9-8-23(2,29)13-33;;/h4-7,10-12,21H,3,8-9,13,29H2,1-2H3;2*1H/t21-,23?;;/m1../s1 |
| InChIKey | BKBOTOMBQZABDR-KXJRWSOGSA-N |
| XLogP | 5.35 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.41 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |