About carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol
carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol (PubChem CID 118510416) has the molecular formula C12H14N2O4
and a molecular weight of 250.25 g/mol. Its IUPAC name is carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol.
Molecular Properties
| Compound Name | carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol |
| PubChem CID | 118510416 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol |
| SMILES | Cc1cc(C)n(-c2ccccc2O)n1.O=C(O)O |
| InChI | InChI=1S/C11H12N2O.CH2O3/c1-8-7-9(2)13(12-8)10-5-3-4-6-11(10)14;2-1(3)4/h3-7,14H,1-2H3;(H2,2,3,4) |
| InChIKey | YDNGPMOMKLNELA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol?
The IUPAC name of carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol (CID 118510416) is carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol.
What is the SMILES notation for carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol?
The canonical SMILES for carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol is Cc1cc(C)n(-c2ccccc2O)n1.O=C(O)O.
What is the InChIKey of carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol?
The InChIKey is YDNGPMOMKLNELA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O.CH2O3/c1-8-7-9(2)13(12-8)10-5-3-4-6-11(10)14;2-1(3)4/h3-7,14H,1-2H3;(H2,2,3,4).
What are the key properties of carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol?
carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol has a molecular weight of 250.25 g/mol, XLogP of 2.42, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;2-(3,5-dimethylpyrazol-1-yl)phenol is sourced from PubChem (CID 118510416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).