C13H18F3NO8S — CID 118510940
[(1R,2R,6R,7R,8S)-7-acetamido-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methyl trifluoromethanesulfonate (PubChem CID 118510940) has the molecular formula C13H18F3NO8S and a molecular weight of 405.35 g/mol. Its IUPAC name is [(1R,2R,6R,7R,8S)-7-acetamido-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(1R,2R,6R,7R,8S)-7-acetamido-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118510940 |
| Molecular Formula | C13H18F3NO8S |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | [(1R,2R,6R,7R,8S)-7-acetamido-4,4-dimethyl-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methyl trifluoromethanesulfonate |
| SMILES | CC(=O)N[C@H]1[C@H]2OC[C@](COS(=O)(=O)C(F)(F)F)(O2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C13H18F3NO8S/c1-6(18)17-7-8-9(24-11(2,3)23-8)12(4-21-10(7)25-12)5-22-26(19,20)13(14,15)16/h7-10H,4-5H2,1-3H3,(H,17,18)/t7-,8-,9-,10+,12-/m1/s1 |
| InChIKey | KVFPQBJYEFUECZ-APWOSFEXSA-N |
| XLogP | 0.00 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|